C20H24N2O4S — CID 100734186
methyl 3-[[(1S)-1-(3,4-dimethoxyphenyl)propyl]carbamothioylamino]benzoate (PubChem CID 100734186) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is methyl 3-[[(1S)-1-(3,4-dimethoxyphenyl)propyl]carbamothioylamino]benzoate.
| Compound Name | methyl 3-[[(1S)-1-(3,4-dimethoxyphenyl)propyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100734186 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | methyl 3-[[(1S)-1-(3,4-dimethoxyphenyl)propyl]carbamothioylamino]benzoate |
| SMILES | CC[C@H](NC(=S)Nc1cccc(C(=O)OC)c1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H24N2O4S/c1-5-16(13-9-10-17(24-2)18(12-13)25-3)22-20(27)21-15-8-6-7-14(11-15)19(23)26-4/h6-12,16H,5H2,1-4H3,(H2,21,22,27)/t16-/m0/s1 |
| InChIKey | FFYZZPAAJMUKQD-INIZCTEOSA-N |
| XLogP | 3.93 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|