C22H30N2O2S — CID 2957972
1-[1-(4-butan-2-ylphenyl)propyl]-3-(3,4-dimethoxyphenyl)thiourea (PubChem CID 2957972) has the molecular formula C22H30N2O2S and a molecular weight of 386.56 g/mol. Its IUPAC name is 1-[1-(4-butan-2-ylphenyl)propyl]-3-(3,4-dimethoxyphenyl)thiourea.
| Compound Name | 1-[1-(4-butan-2-ylphenyl)propyl]-3-(3,4-dimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 2957972 |
| Molecular Formula | C22H30N2O2S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 1-[1-(4-butan-2-ylphenyl)propyl]-3-(3,4-dimethoxyphenyl)thiourea |
| SMILES | CCC(C)c1ccc(C(CC)NC(=S)Nc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C22H30N2O2S/c1-6-15(3)16-8-10-17(11-9-16)19(7-2)24-22(27)23-18-12-13-20(25-4)21(14-18)26-5/h8-15,19H,6-7H2,1-5H3,(H2,23,24,27) |
| InChIKey | GMPNBOVHWZNVLT-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|