C18H22N2O2S — CID 99997533
1-[(1S)-1-(3,4-dimethoxyphenyl)propyl]-3-phenylthiourea (PubChem CID 99997533) has the molecular formula C18H22N2O2S and a molecular weight of 330.45 g/mol. Its IUPAC name is 1-[(1S)-1-(3,4-dimethoxyphenyl)propyl]-3-phenylthiourea.
| Compound Name | 1-[(1S)-1-(3,4-dimethoxyphenyl)propyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 99997533 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 1-[(1S)-1-(3,4-dimethoxyphenyl)propyl]-3-phenylthiourea |
| SMILES | CC[C@H](NC(=S)Nc1ccccc1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C18H22N2O2S/c1-4-15(13-10-11-16(21-2)17(12-13)22-3)20-18(23)19-14-8-6-5-7-9-14/h5-12,15H,4H2,1-3H3,(H2,19,20,23)/t15-/m0/s1 |
| InChIKey | VWSUQORJMLRPJU-HNNXBMFYSA-N |
| XLogP | 4.14 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|