C25H28N2O2S2 — CID 100733914
1-[(1S)-1-(3,4-dimethoxyphenyl)propyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea (PubChem CID 100733914) has the molecular formula C25H28N2O2S2 and a molecular weight of 452.65 g/mol. Its IUPAC name is 1-[(1S)-1-(3,4-dimethoxyphenyl)propyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea.
| Compound Name | 1-[(1S)-1-(3,4-dimethoxyphenyl)propyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100733914 |
| Molecular Formula | C25H28N2O2S2 |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 1-[(1S)-1-(3,4-dimethoxyphenyl)propyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
| SMILES | CC[C@H](NC(=S)Nc1ccc(CSc2ccccc2)cc1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C25H28N2O2S2/c1-4-22(19-12-15-23(28-2)24(16-19)29-3)27-25(30)26-20-13-10-18(11-14-20)17-31-21-8-6-5-7-9-21/h5-16,22H,4,17H2,1-3H3,(H2,26,27,30)/t22-/m0/s1 |
| InChIKey | UONSDOBLNFNERG-QFIPXVFZSA-N |
| XLogP | 6.43 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|