C24H26N2OS2 — CID 100652076
1-[(1R)-1-(4-methoxyphenyl)propyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea (PubChem CID 100652076) has the molecular formula C24H26N2OS2 and a molecular weight of 422.62 g/mol. Its IUPAC name is 1-[(1R)-1-(4-methoxyphenyl)propyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea.
| Compound Name | 1-[(1R)-1-(4-methoxyphenyl)propyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100652076 |
| Molecular Formula | C24H26N2OS2 |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 1-[(1R)-1-(4-methoxyphenyl)propyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
| SMILES | CC[C@@H](NC(=S)Nc1ccc(CSc2ccccc2)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H26N2OS2/c1-3-23(19-11-15-21(27-2)16-12-19)26-24(28)25-20-13-9-18(10-14-20)17-29-22-7-5-4-6-8-22/h4-16,23H,3,17H2,1-2H3,(H2,25,26,28)/t23-/m1/s1 |
| InChIKey | GZVKZHZPZOBGMC-HSZRJFAPSA-N |
| XLogP | 6.43 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|