C19H24N2OS — CID 9218189
1-(3,5-dimethylphenyl)-3-[(1S)-1-(4-methoxyphenyl)propyl]thiourea (PubChem CID 9218189) has the molecular formula C19H24N2OS and a molecular weight of 328.48 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[(1S)-1-(4-methoxyphenyl)propyl]thiourea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[(1S)-1-(4-methoxyphenyl)propyl]thiourea |
|---|---|
| PubChem CID | 9218189 |
| Molecular Formula | C19H24N2OS |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[(1S)-1-(4-methoxyphenyl)propyl]thiourea |
| SMILES | CC[C@H](NC(=S)Nc1cc(C)cc(C)c1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H24N2OS/c1-5-18(15-6-8-17(22-4)9-7-15)21-19(23)20-16-11-13(2)10-14(3)12-16/h6-12,18H,5H2,1-4H3,(H2,20,21,23)/t18-/m0/s1 |
| InChIKey | QBJSYTSERMGRGJ-SFHVURJKSA-N |
| XLogP | 4.75 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|