C20H26N2S — CID 133216449
1-(3,5-dimethylphenyl)-3-[1-(3,4-dimethylphenyl)propyl]thiourea (PubChem CID 133216449) has the molecular formula C20H26N2S and a molecular weight of 326.51 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[1-(3,4-dimethylphenyl)propyl]thiourea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[1-(3,4-dimethylphenyl)propyl]thiourea |
|---|---|
| PubChem CID | 133216449 |
| Molecular Formula | C20H26N2S |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[1-(3,4-dimethylphenyl)propyl]thiourea |
| SMILES | CCC(NC(=S)Nc1cc(C)cc(C)c1)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C20H26N2S/c1-6-19(17-8-7-15(4)16(5)12-17)22-20(23)21-18-10-13(2)9-14(3)11-18/h7-12,19H,6H2,1-5H3,(H2,21,22,23) |
| InChIKey | FTDRFFNYWVIXAO-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|