C20H23N3S — CID 100731065
1-[4-(cyanomethyl)phenyl]-3-[(1S)-1-(3,4-dimethylphenyl)propyl]thiourea (PubChem CID 100731065) has the molecular formula C20H23N3S and a molecular weight of 337.49 g/mol. Its IUPAC name is 1-[4-(cyanomethyl)phenyl]-3-[(1S)-1-(3,4-dimethylphenyl)propyl]thiourea.
| Compound Name | 1-[4-(cyanomethyl)phenyl]-3-[(1S)-1-(3,4-dimethylphenyl)propyl]thiourea |
|---|---|
| PubChem CID | 100731065 |
| Molecular Formula | C20H23N3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 1-[4-(cyanomethyl)phenyl]-3-[(1S)-1-(3,4-dimethylphenyl)propyl]thiourea |
| SMILES | CC[C@H](NC(=S)Nc1ccc(CC#N)cc1)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C20H23N3S/c1-4-19(17-8-5-14(2)15(3)13-17)23-20(24)22-18-9-6-16(7-10-18)11-12-21/h5-10,13,19H,4,11H2,1-3H3,(H2,22,23,24)/t19-/m0/s1 |
| InChIKey | DUALXNTUSKOSAG-IBGZPJMESA-N |
| XLogP | 4.81 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|