C21H25N3O2S — CID 100743113
1-[4-(cyanomethyl)phenyl]-3-[(1S)-1-(3,4-diethoxyphenyl)ethyl]thiourea (PubChem CID 100743113) has the molecular formula C21H25N3O2S and a molecular weight of 383.52 g/mol. Its IUPAC name is 1-[4-(cyanomethyl)phenyl]-3-[(1S)-1-(3,4-diethoxyphenyl)ethyl]thiourea.
| Compound Name | 1-[4-(cyanomethyl)phenyl]-3-[(1S)-1-(3,4-diethoxyphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 100743113 |
| Molecular Formula | C21H25N3O2S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 1-[4-(cyanomethyl)phenyl]-3-[(1S)-1-(3,4-diethoxyphenyl)ethyl]thiourea |
| SMILES | CCOc1ccc([C@H](C)NC(=S)Nc2ccc(CC#N)cc2)cc1OCC |
| InChI | InChI=1S/C21H25N3O2S/c1-4-25-19-11-8-17(14-20(19)26-5-2)15(3)23-21(27)24-18-9-6-16(7-10-18)12-13-22/h6-11,14-15H,4-5,12H2,1-3H3,(H2,23,24,27)/t15-/m0/s1 |
| InChIKey | OUDPQIPEMGAVMU-HNNXBMFYSA-N |
| XLogP | 4.60 |
| TPSA | 66.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|