C24H32N2O3S — CID 100743634
1-(4-cyclopentyloxyphenyl)-3-[(1S)-1-(3,4-diethoxyphenyl)ethyl]thiourea (PubChem CID 100743634) has the molecular formula C24H32N2O3S and a molecular weight of 428.60 g/mol. Its IUPAC name is 1-(4-cyclopentyloxyphenyl)-3-[(1S)-1-(3,4-diethoxyphenyl)ethyl]thiourea.
| Compound Name | 1-(4-cyclopentyloxyphenyl)-3-[(1S)-1-(3,4-diethoxyphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 100743634 |
| Molecular Formula | C24H32N2O3S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 1-(4-cyclopentyloxyphenyl)-3-[(1S)-1-(3,4-diethoxyphenyl)ethyl]thiourea |
| SMILES | CCOc1ccc([C@H](C)NC(=S)Nc2ccc(OC3CCCC3)cc2)cc1OCC |
| InChI | InChI=1S/C24H32N2O3S/c1-4-27-22-15-10-18(16-23(22)28-5-2)17(3)25-24(30)26-19-11-13-21(14-12-19)29-20-8-6-7-9-20/h10-17,20H,4-9H2,1-3H3,(H2,25,26,30)/t17-/m0/s1 |
| InChIKey | UWZJLXZHJMXSGX-KRWDZBQOSA-N |
| XLogP | 5.85 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|