C19H23BrN2O2S — CID 92524501
1-(3-bromophenyl)-3-[(1S)-1-(3,4-diethoxyphenyl)ethyl]thiourea (PubChem CID 92524501) has the molecular formula C19H23BrN2O2S and a molecular weight of 423.38 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-[(1S)-1-(3,4-diethoxyphenyl)ethyl]thiourea.
| Compound Name | 1-(3-bromophenyl)-3-[(1S)-1-(3,4-diethoxyphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 92524501 |
| Molecular Formula | C19H23BrN2O2S |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 1-(3-bromophenyl)-3-[(1S)-1-(3,4-diethoxyphenyl)ethyl]thiourea |
| SMILES | CCOc1ccc([C@H](C)NC(=S)Nc2cccc(Br)c2)cc1OCC |
| InChI | InChI=1S/C19H23BrN2O2S/c1-4-23-17-10-9-14(11-18(17)24-5-2)13(3)21-19(25)22-16-8-6-7-15(20)12-16/h6-13H,4-5H2,1-3H3,(H2,21,22,25)/t13-/m0/s1 |
| InChIKey | IYRGODWFXMEZHH-ZDUSSCGKSA-N |
| XLogP | 5.29 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|