C20H24BrNO3 — CID 100701725
2-(3-bromophenyl)-N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]acetamide (PubChem CID 100701725) has the molecular formula C20H24BrNO3 and a molecular weight of 406.32 g/mol. Its IUPAC name is 2-(3-bromophenyl)-N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(3-bromophenyl)-N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 100701725 |
| Molecular Formula | C20H24BrNO3 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 2-(3-bromophenyl)-N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]acetamide |
| SMILES | CCOc1ccc([C@H](C)NC(=O)Cc2cccc(Br)c2)cc1OCC |
| InChI | InChI=1S/C20H24BrNO3/c1-4-24-18-10-9-16(13-19(18)25-5-2)14(3)22-20(23)12-15-7-6-8-17(21)11-15/h6-11,13-14H,4-5,12H2,1-3H3,(H,22,23)/t14-/m0/s1 |
| InChIKey | ZKHVCDUURXOUAG-AWEZNQCLSA-N |
| XLogP | 4.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |