C18H21BrN2O2S — CID 100667233
1-(3-bromophenyl)-3-[(3,4-diethoxyphenyl)methyl]thiourea (PubChem CID 100667233) has the molecular formula C18H21BrN2O2S and a molecular weight of 409.35 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-[(3,4-diethoxyphenyl)methyl]thiourea.
| Compound Name | 1-(3-bromophenyl)-3-[(3,4-diethoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 100667233 |
| Molecular Formula | C18H21BrN2O2S |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 1-(3-bromophenyl)-3-[(3,4-diethoxyphenyl)methyl]thiourea |
| SMILES | CCOc1ccc(CNC(=S)Nc2cccc(Br)c2)cc1OCC |
| InChI | InChI=1S/C18H21BrN2O2S/c1-3-22-16-9-8-13(10-17(16)23-4-2)12-20-18(24)21-15-7-5-6-14(19)11-15/h5-11H,3-4,12H2,1-2H3,(H2,20,21,24) |
| InChIKey | RWIRRZQYYVQVHH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|