C19H21F3N2O2S — CID 100667421
1-[(3,4-diethoxyphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]thiourea (PubChem CID 100667421) has the molecular formula C19H21F3N2O2S and a molecular weight of 398.45 g/mol. Its IUPAC name is 1-[(3,4-diethoxyphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(3,4-diethoxyphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100667421 |
| Molecular Formula | C19H21F3N2O2S |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 1-[(3,4-diethoxyphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]thiourea |
| SMILES | CCOc1ccc(CNC(=S)Nc2ccc(C(F)(F)F)cc2)cc1OCC |
| InChI | InChI=1S/C19H21F3N2O2S/c1-3-25-16-10-5-13(11-17(16)26-4-2)12-23-18(27)24-15-8-6-14(7-9-15)19(20,21)22/h5-11H,3-4,12H2,1-2H3,(H2,23,24,27) |
| InChIKey | NMKVNCCJRJZMQD-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|