C18H16F3N3S — CID 3615848
1-[(2-methyl-1H-indol-5-yl)methyl]-3-[4-(trifluoromethyl)phenyl]thiourea (PubChem CID 3615848) has the molecular formula C18H16F3N3S and a molecular weight of 363.41 g/mol. Its IUPAC name is 1-[(2-methyl-1H-indol-5-yl)methyl]-3-[4-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(2-methyl-1H-indol-5-yl)methyl]-3-[4-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 3615848 |
| Molecular Formula | C18H16F3N3S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 1-[(2-methyl-1H-indol-5-yl)methyl]-3-[4-(trifluoromethyl)phenyl]thiourea |
| SMILES | Cc1cc2cc(CNC(=S)Nc3ccc(C(F)(F)F)cc3)ccc2[nH]1 |
| InChI | InChI=1S/C18H16F3N3S/c1-11-8-13-9-12(2-7-16(13)23-11)10-22-17(25)24-15-5-3-14(4-6-15)18(19,20)21/h2-9,23H,10H2,1H3,(H2,22,24,25) |
| InChIKey | ORLPYWVVMQKWPH-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|