C17H15FN2O — CID 5096418
4-fluoro-N-[(2-methyl-1H-indol-5-yl)methyl]benzamide (PubChem CID 5096418) has the molecular formula C17H15FN2O and a molecular weight of 282.32 g/mol. Its IUPAC name is 4-fluoro-N-[(2-methyl-1H-indol-5-yl)methyl]benzamide.
| Compound Name | 4-fluoro-N-[(2-methyl-1H-indol-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 5096418 |
| Molecular Formula | C17H15FN2O |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 4-fluoro-N-[(2-methyl-1H-indol-5-yl)methyl]benzamide |
| SMILES | Cc1cc2cc(CNC(=O)c3ccc(F)cc3)ccc2[nH]1 |
| InChI | InChI=1S/C17H15FN2O/c1-11-8-14-9-12(2-7-16(14)20-11)10-19-17(21)13-3-5-15(18)6-4-13/h2-9,20H,10H2,1H3,(H,19,21) |
| InChIKey | XHJODRGZABQGFT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |