C15H21N3O — CID 110668194
1-tert-butyl-3-[(2-methyl-1H-indol-5-yl)methyl]urea (PubChem CID 110668194) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 1-tert-butyl-3-[(2-methyl-1H-indol-5-yl)methyl]urea.
| Compound Name | 1-tert-butyl-3-[(2-methyl-1H-indol-5-yl)methyl]urea |
|---|---|
| PubChem CID | 110668194 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 1-tert-butyl-3-[(2-methyl-1H-indol-5-yl)methyl]urea |
| SMILES | Cc1cc2cc(CNC(=O)NC(C)(C)C)ccc2[nH]1 |
| InChI | InChI=1S/C15H21N3O/c1-10-7-12-8-11(5-6-13(12)17-10)9-16-14(19)18-15(2,3)4/h5-8,17H,9H2,1-4H3,(H2,16,18,19) |
| InChIKey | YYYKPSBZVBUZIS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |