C13H18N4 — CID 166192902
1,2-dimethyl-3-[(2-methyl-1H-indol-5-yl)methyl]guanidine (PubChem CID 166192902) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is 1,2-dimethyl-3-[(2-methyl-1H-indol-5-yl)methyl]guanidine.
| Compound Name | 1,2-dimethyl-3-[(2-methyl-1H-indol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 166192902 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 1,2-dimethyl-3-[(2-methyl-1H-indol-5-yl)methyl]guanidine |
| SMILES | C/N=C(\NC)NCc1ccc2[nH]c(C)cc2c1 |
| InChI | InChI=1S/C13H18N4/c1-9-6-11-7-10(4-5-12(11)17-9)8-16-13(14-2)15-3/h4-7,17H,8H2,1-3H3,(H2,14,15,16) |
| InChIKey | XMMIAVDGCAFRIU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|