C14H18IN3 — CID 110918471
1,2-dimethyl-3-(naphthalen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110918471) has the molecular formula C14H18IN3 and a molecular weight of 355.22 g/mol. Its IUPAC name is 1,2-dimethyl-3-(naphthalen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-3-(naphthalen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110918471 |
| Molecular Formula | C14H18IN3 |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 1,2-dimethyl-3-(naphthalen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NC)NCc1ccc2ccccc2c1.I |
| InChI | InChI=1S/C14H17N3.HI/c1-15-14(16-2)17-10-11-7-8-12-5-3-4-6-13(12)9-11;/h3-9H,10H2,1-2H3,(H2,15,16,17);1H |
| InChIKey | MUXIFZDLKXOKEO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|