C20H20N2O — CID 110425618
(E)-2-methyl-N-[(2-methyl-1H-indol-5-yl)methyl]-3-phenylprop-2-enamide (PubChem CID 110425618) has the molecular formula C20H20N2O and a molecular weight of 304.39 g/mol. Its IUPAC name is (E)-2-methyl-N-[(2-methyl-1H-indol-5-yl)methyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-2-methyl-N-[(2-methyl-1H-indol-5-yl)methyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 110425618 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (E)-2-methyl-N-[(2-methyl-1H-indol-5-yl)methyl]-3-phenylprop-2-enamide |
| SMILES | C/C(=C\c1ccccc1)C(=O)NCc1ccc2[nH]c(C)cc2c1 |
| InChI | InChI=1S/C20H20N2O/c1-14(10-16-6-4-3-5-7-16)20(23)21-13-17-8-9-19-18(12-17)11-15(2)22-19/h3-12,22H,13H2,1-2H3,(H,21,23)/b14-10+ |
| InChIKey | UWLGMUCTXUBEHN-GXDHUFHOSA-N |
| XLogP | 4.20 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|