C22H21N3O3 — CID 110427774
4-(1,3-dioxoisoindol-2-yl)-N-[(2-methyl-1H-indol-5-yl)methyl]butanamide (PubChem CID 110427774) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-[(2-methyl-1H-indol-5-yl)methyl]butanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-[(2-methyl-1H-indol-5-yl)methyl]butanamide |
|---|---|
| PubChem CID | 110427774 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-[(2-methyl-1H-indol-5-yl)methyl]butanamide |
| SMILES | Cc1cc2cc(CNC(=O)CCCN3C(=O)c4ccccc4C3=O)ccc2[nH]1 |
| InChI | InChI=1S/C22H21N3O3/c1-14-11-16-12-15(8-9-19(16)24-14)13-23-20(26)7-4-10-25-21(27)17-5-2-3-6-18(17)22(25)28/h2-3,5-6,8-9,11-12,24H,4,7,10,13H2,1H3,(H,23,26) |
| InChIKey | PCSNCIAVIYLBNG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|