C17H14BrClN2O — CID 167798638
3-bromo-2-chloro-N-[(2-methyl-1H-indol-5-yl)methyl]benzamide (PubChem CID 167798638) has the molecular formula C17H14BrClN2O and a molecular weight of 377.67 g/mol. Its IUPAC name is 3-bromo-2-chloro-N-[(2-methyl-1H-indol-5-yl)methyl]benzamide.
| Compound Name | 3-bromo-2-chloro-N-[(2-methyl-1H-indol-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 167798638 |
| Molecular Formula | C17H14BrClN2O |
| Molecular Weight | 377.67 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | 3-bromo-2-chloro-N-[(2-methyl-1H-indol-5-yl)methyl]benzamide |
| SMILES | Cc1cc2cc(CNC(=O)c3cccc(Br)c3Cl)ccc2[nH]1 |
| InChI | InChI=1S/C17H14BrClN2O/c1-10-7-12-8-11(5-6-15(12)21-10)9-20-17(22)13-3-2-4-14(18)16(13)19/h2-8,21H,9H2,1H3,(H,20,22) |
| InChIKey | VBLQWSWJIPWEEN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.67 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |