C16H15F3N2S — CID 17262922
1-(3,5-dimethylphenyl)-3-[4-(trifluoromethyl)phenyl]thiourea (PubChem CID 17262922) has the molecular formula C16H15F3N2S and a molecular weight of 324.37 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[4-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[4-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 17262922 |
| Molecular Formula | C16H15F3N2S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[4-(trifluoromethyl)phenyl]thiourea |
| SMILES | Cc1cc(C)cc(NC(=S)Nc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C16H15F3N2S/c1-10-7-11(2)9-14(8-10)21-15(22)20-13-5-3-12(4-6-13)16(17,18)19/h3-9H,1-2H3,(H2,20,21,22) |
| InChIKey | PARHOMOYDGZMOC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|