C17H17F3N2O3S — CID 17312818
1-[4-(trifluoromethyl)phenyl]-3-(3,4,5-trimethoxyphenyl)thiourea (PubChem CID 17312818) has the molecular formula C17H17F3N2O3S and a molecular weight of 386.40 g/mol. Its IUPAC name is 1-[4-(trifluoromethyl)phenyl]-3-(3,4,5-trimethoxyphenyl)thiourea.
| Compound Name | 1-[4-(trifluoromethyl)phenyl]-3-(3,4,5-trimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 17312818 |
| Molecular Formula | C17H17F3N2O3S |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 1-[4-(trifluoromethyl)phenyl]-3-(3,4,5-trimethoxyphenyl)thiourea |
| SMILES | COc1cc(NC(=S)Nc2ccc(C(F)(F)F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C17H17F3N2O3S/c1-23-13-8-12(9-14(24-2)15(13)25-3)22-16(26)21-11-6-4-10(5-7-11)17(18,19)20/h4-9H,1-3H3,(H2,21,22,26) |
| InChIKey | ZDRAXIXOTLYEDA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|