C20H17F3N2O5 — CID 67839956
2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 67839956) has the molecular formula C20H17F3N2O5 and a molecular weight of 422.36 g/mol. Its IUPAC name is 2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | 2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 67839956 |
| Molecular Formula | C20H17F3N2O5 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(C(O)=C(C#N)C(=O)Nc2ccc(C(F)(F)F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C20H17F3N2O5/c1-28-15-8-11(9-16(29-2)18(15)30-3)17(26)14(10-24)19(27)25-13-6-4-12(5-7-13)20(21,22)23/h4-9,26H,1-3H3,(H,25,27) |
| InChIKey | XCPKZIXXYWVHNN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|