C17H10ClF3N2O2 — CID 54727447
(Z)-N-(4-chlorophenyl)-2-cyano-3-hydroxy-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 54727447) has the molecular formula C17H10ClF3N2O2 and a molecular weight of 366.73 g/mol. Its IUPAC name is (Z)-N-(4-chlorophenyl)-2-cyano-3-hydroxy-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (Z)-N-(4-chlorophenyl)-2-cyano-3-hydroxy-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 54727447 |
| Molecular Formula | C17H10ClF3N2O2 |
| Molecular Weight | 366.73 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | (Z)-N-(4-chlorophenyl)-2-cyano-3-hydroxy-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | N#C/C(C(=O)Nc1ccc(Cl)cc1)=C(/O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H10ClF3N2O2/c18-12-5-7-13(8-6-12)23-16(25)14(9-22)15(24)10-1-3-11(4-2-10)17(19,20)21/h1-8,24H,(H,23,25)/b15-14- |
| InChIKey | MFQWSWSYRAFLJC-PFONDFGASA-N |
| XLogP | 4.79 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.73 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|