C23H14ClF3N2O2S — CID 54727459
(Z)-N-[4-(4-chlorophenyl)sulfanylphenyl]-2-cyano-3-hydroxy-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 54727459) has the molecular formula C23H14ClF3N2O2S and a molecular weight of 474.89 g/mol. Its IUPAC name is (Z)-N-[4-(4-chlorophenyl)sulfanylphenyl]-2-cyano-3-hydroxy-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (Z)-N-[4-(4-chlorophenyl)sulfanylphenyl]-2-cyano-3-hydroxy-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 54727459 |
| Molecular Formula | C23H14ClF3N2O2S |
| Molecular Weight | 474.89 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | (Z)-N-[4-(4-chlorophenyl)sulfanylphenyl]-2-cyano-3-hydroxy-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | N#C/C(C(=O)Nc1ccc(Sc2ccc(Cl)cc2)cc1)=C(/O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H14ClF3N2O2S/c24-16-5-9-18(10-6-16)32-19-11-7-17(8-12-19)29-22(31)20(13-28)21(30)14-1-3-15(4-2-14)23(25,26)27/h1-12,30H,(H,29,31)/b21-20- |
| InChIKey | WPBIKUZMDZXFBE-MRCUWXFGSA-N |
| XLogP | 6.94 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.89 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|