C15H13F3N2O3 — CID 54710486
(Z)-2-cyano-3-hydroxy-3-(oxolan-3-yl)-N-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 54710486) has the molecular formula C15H13F3N2O3 and a molecular weight of 326.27 g/mol. Its IUPAC name is (Z)-2-cyano-3-hydroxy-3-(oxolan-3-yl)-N-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-hydroxy-3-(oxolan-3-yl)-N-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 54710486 |
| Molecular Formula | C15H13F3N2O3 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | (Z)-2-cyano-3-hydroxy-3-(oxolan-3-yl)-N-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | N#C/C(C(=O)Nc1ccc(C(F)(F)F)cc1)=C(/O)C1CCOC1 |
| InChI | InChI=1S/C15H13F3N2O3/c16-15(17,18)10-1-3-11(4-2-10)20-14(22)12(7-19)13(21)9-5-6-23-8-9/h1-4,9,21H,5-6,8H2,(H,20,22)/b13-12- |
| InChIKey | YSYRGNVRWOFVJJ-SEYXRHQNSA-N |
| XLogP | 3.02 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|