C18H19F3N2O3Si — CID 69450462
(E)-2-cyano-3,5-dihydroxy-N-[4-(trifluoromethyl)phenyl]-7-trimethylsilylhept-2-en-6-ynamide (PubChem CID 69450462) has the molecular formula C18H19F3N2O3Si and a molecular weight of 396.44 g/mol. Its IUPAC name is (E)-2-cyano-3,5-dihydroxy-N-[4-(trifluoromethyl)phenyl]-7-trimethylsilylhept-2-en-6-ynamide.
| Compound Name | (E)-2-cyano-3,5-dihydroxy-N-[4-(trifluoromethyl)phenyl]-7-trimethylsilylhept-2-en-6-ynamide |
|---|---|
| PubChem CID | 69450462 |
| Molecular Formula | C18H19F3N2O3Si |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | (E)-2-cyano-3,5-dihydroxy-N-[4-(trifluoromethyl)phenyl]-7-trimethylsilylhept-2-en-6-ynamide |
| SMILES | C[Si](C)(C)C#CC(O)C/C(O)=C(/C#N)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H19F3N2O3Si/c1-27(2,3)9-8-14(24)10-16(25)15(11-22)17(26)23-13-6-4-12(5-7-13)18(19,20)21/h4-7,14,24-25H,10H2,1-3H3,(H,23,26)/b16-15+ |
| InChIKey | KRFUUFMQDAVHRI-FOCLMDBBSA-N |
| XLogP | 3.61 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|