C22H29F3N2O2 — CID 67839989
2-cyano-3-hydroxy-4-pentyl-N-[4-(trifluoromethyl)phenyl]non-2-enamide (PubChem CID 67839989) has the molecular formula C22H29F3N2O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 2-cyano-3-hydroxy-4-pentyl-N-[4-(trifluoromethyl)phenyl]non-2-enamide.
| Compound Name | 2-cyano-3-hydroxy-4-pentyl-N-[4-(trifluoromethyl)phenyl]non-2-enamide |
|---|---|
| PubChem CID | 67839989 |
| Molecular Formula | C22H29F3N2O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 2-cyano-3-hydroxy-4-pentyl-N-[4-(trifluoromethyl)phenyl]non-2-enamide |
| SMILES | CCCCCC(CCCCC)C(O)=C(C#N)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H29F3N2O2/c1-3-5-7-9-16(10-8-6-4-2)20(28)19(15-26)21(29)27-18-13-11-17(12-14-18)22(23,24)25/h11-14,16,28H,3-10H2,1-2H3,(H,27,29) |
| InChIKey | SEELPXNWICSYEQ-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|