C10H6F3N3O2 — CID 51033251
(2E)-2-cyano-2-hydroxyimino-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 51033251) has the molecular formula C10H6F3N3O2 and a molecular weight of 257.17 g/mol. Its IUPAC name is (2E)-2-cyano-2-hydroxyimino-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | (2E)-2-cyano-2-hydroxyimino-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 51033251 |
| Molecular Formula | C10H6F3N3O2 |
| Molecular Weight | 257.17 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | (2E)-2-cyano-2-hydroxyimino-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | N#C/C(=N\O)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H6F3N3O2/c11-10(12,13)6-1-3-7(4-2-6)15-9(17)8(5-14)16-18/h1-4,18H,(H,15,17)/b16-8+ |
| InChIKey | QCANERAOMDIKFF-LZYBPNLTSA-N |
| XLogP | 2.00 |
| TPSA | 85.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.17 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|