C10H7ClN2OS2 — CID 11197815
N-(4-chlorophenyl)-2-cyano-3,3-bis(sulfanyl)prop-2-enamide (PubChem CID 11197815) has the molecular formula C10H7ClN2OS2 and a molecular weight of 270.77 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-cyano-3,3-bis(sulfanyl)prop-2-enamide.
| Compound Name | N-(4-chlorophenyl)-2-cyano-3,3-bis(sulfanyl)prop-2-enamide |
|---|---|
| PubChem CID | 11197815 |
| Molecular Formula | C10H7ClN2OS2 |
| Molecular Weight | 270.77 g/mol |
| Exact Mass | 269.97 |
| IUPAC Name | N-(4-chlorophenyl)-2-cyano-3,3-bis(sulfanyl)prop-2-enamide |
| SMILES | N#CC(C(=O)Nc1ccc(Cl)cc1)=C(S)S |
| InChI | InChI=1S/C10H7ClN2OS2/c11-6-1-3-7(4-2-6)13-9(14)8(5-12)10(15)16/h1-4,15-16H,(H,13,14) |
| InChIKey | JFUYQSANCJMDQA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.77 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|