C24H19ClN2OS2 — CID 4624833
3,3-bis(benzylsulfanyl)-N-(4-chlorophenyl)-2-cyanoprop-2-enamide (PubChem CID 4624833) has the molecular formula C24H19ClN2OS2 and a molecular weight of 451.02 g/mol. Its IUPAC name is 3,3-bis(benzylsulfanyl)-N-(4-chlorophenyl)-2-cyanoprop-2-enamide.
| Compound Name | 3,3-bis(benzylsulfanyl)-N-(4-chlorophenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 4624833 |
| Molecular Formula | C24H19ClN2OS2 |
| Molecular Weight | 451.02 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 3,3-bis(benzylsulfanyl)-N-(4-chlorophenyl)-2-cyanoprop-2-enamide |
| SMILES | N#CC(C(=O)Nc1ccc(Cl)cc1)=C(SCc1ccccc1)SCc1ccccc1 |
| InChI | InChI=1S/C24H19ClN2OS2/c25-20-11-13-21(14-12-20)27-23(28)22(15-26)24(29-16-18-7-3-1-4-8-18)30-17-19-9-5-2-6-10-19/h1-14H,16-17H2,(H,27,28) |
| InChIKey | XBVRMMLHOFCQLI-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.02 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|