C24H22N4O — CID 108818087
(Z)-N-(4-aminophenyl)-2-cyano-3-(dibenzylamino)prop-2-enamide (PubChem CID 108818087) has the molecular formula C24H22N4O and a molecular weight of 382.47 g/mol. Its IUPAC name is (Z)-N-(4-aminophenyl)-2-cyano-3-(dibenzylamino)prop-2-enamide.
| Compound Name | (Z)-N-(4-aminophenyl)-2-cyano-3-(dibenzylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108818087 |
| Molecular Formula | C24H22N4O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | (Z)-N-(4-aminophenyl)-2-cyano-3-(dibenzylamino)prop-2-enamide |
| SMILES | N#C/C(=C/N(Cc1ccccc1)Cc1ccccc1)C(=O)Nc1ccc(N)cc1 |
| InChI | InChI=1S/C24H22N4O/c25-15-21(24(29)27-23-13-11-22(26)12-14-23)18-28(16-19-7-3-1-4-8-19)17-20-9-5-2-6-10-20/h1-14,18H,16-17,26H2,(H,27,29)/b21-18- |
| InChIKey | FNVUXJXXSFIXBS-UZYVYHOESA-N |
| XLogP | 4.32 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|