C30H25N3O2 — CID 108849689
(Z)-2-cyano-3-(dibenzylamino)-N-(4-phenoxyphenyl)prop-2-enamide (PubChem CID 108849689) has the molecular formula C30H25N3O2 and a molecular weight of 459.55 g/mol. Its IUPAC name is (Z)-2-cyano-3-(dibenzylamino)-N-(4-phenoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(dibenzylamino)-N-(4-phenoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108849689 |
| Molecular Formula | C30H25N3O2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | (Z)-2-cyano-3-(dibenzylamino)-N-(4-phenoxyphenyl)prop-2-enamide |
| SMILES | N#C/C(=C/N(Cc1ccccc1)Cc1ccccc1)C(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C30H25N3O2/c31-20-26(23-33(21-24-10-4-1-5-11-24)22-25-12-6-2-7-13-25)30(34)32-27-16-18-29(19-17-27)35-28-14-8-3-9-15-28/h1-19,23H,21-22H2,(H,32,34)/b26-23- |
| InChIKey | WCMDSJWRXXFLTI-RWEWTDSWSA-N |
| XLogP | 6.53 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|