C21H22N4O3 — CID 108818639
(Z)-N-(4-acetamidophenyl)-3-[benzyl(2-hydroxyethyl)amino]-2-cyanoprop-2-enamide (PubChem CID 108818639) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is (Z)-N-(4-acetamidophenyl)-3-[benzyl(2-hydroxyethyl)amino]-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-(4-acetamidophenyl)-3-[benzyl(2-hydroxyethyl)amino]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108818639 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (Z)-N-(4-acetamidophenyl)-3-[benzyl(2-hydroxyethyl)amino]-2-cyanoprop-2-enamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)/C(C#N)=C\N(CCO)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H22N4O3/c1-16(27)23-19-7-9-20(10-8-19)24-21(28)18(13-22)15-25(11-12-26)14-17-5-3-2-4-6-17/h2-10,15,26H,11-12,14H2,1H3,(H,23,27)(H,24,28)/b18-15- |
| InChIKey | IYTFELUYLJORKO-SDXDJHTJSA-N |
| XLogP | 2.49 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|