C14H16N4O4 — CID 108853049
(Z)-2-cyano-3-[ethyl(2-hydroxyethyl)amino]-N-(4-nitrophenyl)prop-2-enamide (PubChem CID 108853049) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is (Z)-2-cyano-3-[ethyl(2-hydroxyethyl)amino]-N-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[ethyl(2-hydroxyethyl)amino]-N-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108853049 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (Z)-2-cyano-3-[ethyl(2-hydroxyethyl)amino]-N-(4-nitrophenyl)prop-2-enamide |
| SMILES | CCN(/C=C(/C#N)C(=O)Nc1ccc([N+](=O)[O-])cc1)CCO |
| InChI | InChI=1S/C14H16N4O4/c1-2-17(7-8-19)10-11(9-15)14(20)16-12-3-5-13(6-4-12)18(21)22/h3-6,10,19H,2,7-8H2,1H3,(H,16,20)/b11-10- |
| InChIKey | IOGOBQWIMIPGHT-KHPPLWFESA-N |
| XLogP | 1.25 |
| TPSA | 119.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|