C19H20N4O4S — CID 108819241
4-[[(Z)-2-cyano-3-[ethyl(2-pyridin-4-ylethyl)amino]prop-2-enoyl]amino]benzenesulfonic acid (PubChem CID 108819241) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is 4-[[(Z)-2-cyano-3-[ethyl(2-pyridin-4-ylethyl)amino]prop-2-enoyl]amino]benzenesulfonic acid.
| Compound Name | 4-[[(Z)-2-cyano-3-[ethyl(2-pyridin-4-ylethyl)amino]prop-2-enoyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 108819241 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 4-[[(Z)-2-cyano-3-[ethyl(2-pyridin-4-ylethyl)amino]prop-2-enoyl]amino]benzenesulfonic acid |
| SMILES | CCN(/C=C(/C#N)C(=O)Nc1ccc(S(=O)(=O)O)cc1)CCc1ccncc1 |
| InChI | InChI=1S/C19H20N4O4S/c1-2-23(12-9-15-7-10-21-11-8-15)14-16(13-20)19(24)22-17-3-5-18(6-4-17)28(25,26)27/h3-8,10-11,14H,2,9,12H2,1H3,(H,22,24)(H,25,26,27)/b16-14- |
| InChIKey | LABKHTQJHIHQCX-PEZBUJJGSA-N |
| XLogP | 2.24 |
| TPSA | 123.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|