C11H12N4O — CID 2799818
(E)-2-cyano-3-(dimethylamino)-N-pyridin-4-ylprop-2-enamide (PubChem CID 2799818) has the molecular formula C11H12N4O and a molecular weight of 216.24 g/mol. Its IUPAC name is (E)-2-cyano-3-(dimethylamino)-N-pyridin-4-ylprop-2-enamide.
| Compound Name | (E)-2-cyano-3-(dimethylamino)-N-pyridin-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 2799818 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | (E)-2-cyano-3-(dimethylamino)-N-pyridin-4-ylprop-2-enamide |
| SMILES | CN(C)/C=C(\C#N)C(=O)Nc1ccncc1 |
| InChI | InChI=1S/C11H12N4O/c1-15(2)8-9(7-12)11(16)14-10-3-5-13-6-4-10/h3-6,8H,1-2H3,(H,13,14,16)/b9-8+ |
| InChIKey | DNJXCVNRBQTUSY-CMDGGOBGSA-N |
| XLogP | 0.99 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|