C12H12ClN3O — CID 3759138
N-(3-chlorophenyl)-2-cyano-3-(dimethylamino)prop-2-enamide (PubChem CID 3759138) has the molecular formula C12H12ClN3O and a molecular weight of 249.70 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-cyano-3-(dimethylamino)prop-2-enamide.
| Compound Name | N-(3-chlorophenyl)-2-cyano-3-(dimethylamino)prop-2-enamide |
|---|---|
| PubChem CID | 3759138 |
| Molecular Formula | C12H12ClN3O |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | N-(3-chlorophenyl)-2-cyano-3-(dimethylamino)prop-2-enamide |
| SMILES | CN(C)C=C(C#N)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H12ClN3O/c1-16(2)8-9(7-14)12(17)15-11-5-3-4-10(13)6-11/h3-6,8H,1-2H3,(H,15,17) |
| InChIKey | WVSMGGAWGSSPNK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|