C15H12N4O4S — CID 108819227
4-[[(Z)-2-cyano-3-(pyridin-3-ylamino)prop-2-enoyl]amino]benzenesulfonic acid (PubChem CID 108819227) has the molecular formula C15H12N4O4S and a molecular weight of 344.35 g/mol. Its IUPAC name is 4-[[(Z)-2-cyano-3-(pyridin-3-ylamino)prop-2-enoyl]amino]benzenesulfonic acid.
| Compound Name | 4-[[(Z)-2-cyano-3-(pyridin-3-ylamino)prop-2-enoyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 108819227 |
| Molecular Formula | C15H12N4O4S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 4-[[(Z)-2-cyano-3-(pyridin-3-ylamino)prop-2-enoyl]amino]benzenesulfonic acid |
| SMILES | N#C/C(=C/Nc1cccnc1)C(=O)Nc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C15H12N4O4S/c16-8-11(9-18-13-2-1-7-17-10-13)15(20)19-12-3-5-14(6-4-12)24(21,22)23/h1-7,9-10,18H,(H,19,20)(H,21,22,23)/b11-9- |
| InChIKey | BTMZPSQCHWQOMK-LUAWRHEFSA-N |
| XLogP | 1.79 |
| TPSA | 132.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|