C18H17N3O4S — CID 108819202
4-[[(Z)-2-cyano-3-(3,4-dimethylanilino)prop-2-enoyl]amino]benzenesulfonic acid (PubChem CID 108819202) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is 4-[[(Z)-2-cyano-3-(3,4-dimethylanilino)prop-2-enoyl]amino]benzenesulfonic acid.
| Compound Name | 4-[[(Z)-2-cyano-3-(3,4-dimethylanilino)prop-2-enoyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 108819202 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 4-[[(Z)-2-cyano-3-(3,4-dimethylanilino)prop-2-enoyl]amino]benzenesulfonic acid |
| SMILES | Cc1ccc(N/C=C(/C#N)C(=O)Nc2ccc(S(=O)(=O)O)cc2)cc1C |
| InChI | InChI=1S/C18H17N3O4S/c1-12-3-4-16(9-13(12)2)20-11-14(10-19)18(22)21-15-5-7-17(8-6-15)26(23,24)25/h3-9,11,20H,1-2H3,(H,21,22)(H,23,24,25)/b14-11- |
| InChIKey | OGCUMASWFAJDHJ-KAMYIIQDSA-N |
| XLogP | 3.01 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|