C16H14N4O4S — CID 108819164
4-[[(Z)-2-cyano-3-(pyridin-4-ylmethylamino)prop-2-enoyl]amino]benzenesulfonic acid (PubChem CID 108819164) has the molecular formula C16H14N4O4S and a molecular weight of 358.38 g/mol. Its IUPAC name is 4-[[(Z)-2-cyano-3-(pyridin-4-ylmethylamino)prop-2-enoyl]amino]benzenesulfonic acid.
| Compound Name | 4-[[(Z)-2-cyano-3-(pyridin-4-ylmethylamino)prop-2-enoyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 108819164 |
| Molecular Formula | C16H14N4O4S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 4-[[(Z)-2-cyano-3-(pyridin-4-ylmethylamino)prop-2-enoyl]amino]benzenesulfonic acid |
| SMILES | N#C/C(=C/NCc1ccncc1)C(=O)Nc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C16H14N4O4S/c17-9-13(11-19-10-12-5-7-18-8-6-12)16(21)20-14-1-3-15(4-2-14)25(22,23)24/h1-8,11,19H,10H2,(H,20,21)(H,22,23,24)/b13-11- |
| InChIKey | PJEBLXSIDOHQJW-QBFSEMIESA-N |
| XLogP | 1.46 |
| TPSA | 132.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|