C20H22N4O — CID 108842279
(Z)-N-benzyl-2-cyano-3-[ethyl(2-pyridin-4-ylethyl)amino]prop-2-enamide (PubChem CID 108842279) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is (Z)-N-benzyl-2-cyano-3-[ethyl(2-pyridin-4-ylethyl)amino]prop-2-enamide.
| Compound Name | (Z)-N-benzyl-2-cyano-3-[ethyl(2-pyridin-4-ylethyl)amino]prop-2-enamide |
|---|---|
| PubChem CID | 108842279 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (Z)-N-benzyl-2-cyano-3-[ethyl(2-pyridin-4-ylethyl)amino]prop-2-enamide |
| SMILES | CCN(/C=C(/C#N)C(=O)NCc1ccccc1)CCc1ccncc1 |
| InChI | InChI=1S/C20H22N4O/c1-2-24(13-10-17-8-11-22-12-9-17)16-19(14-21)20(25)23-15-18-6-4-3-5-7-18/h3-9,11-12,16H,2,10,13,15H2,1H3,(H,23,25)/b19-16- |
| InChIKey | RCCWSTOJGCZVGP-MNDPQUGUSA-N |
| XLogP | 2.67 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|