C23H18FN3OS — CID 45105763
(E)-3-anilino-2-cyano-3-[(2-fluorophenyl)methylsulfanyl]-N-phenylprop-2-enamide (PubChem CID 45105763) has the molecular formula C23H18FN3OS and a molecular weight of 403.48 g/mol. Its IUPAC name is (E)-3-anilino-2-cyano-3-[(2-fluorophenyl)methylsulfanyl]-N-phenylprop-2-enamide.
| Compound Name | (E)-3-anilino-2-cyano-3-[(2-fluorophenyl)methylsulfanyl]-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 45105763 |
| Molecular Formula | C23H18FN3OS |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | (E)-3-anilino-2-cyano-3-[(2-fluorophenyl)methylsulfanyl]-N-phenylprop-2-enamide |
| SMILES | N#C/C(C(=O)Nc1ccccc1)=C(/Nc1ccccc1)SCc1ccccc1F |
| InChI | InChI=1S/C23H18FN3OS/c24-21-14-8-7-9-17(21)16-29-23(27-19-12-5-2-6-13-19)20(15-25)22(28)26-18-10-3-1-4-11-18/h1-14,27H,16H2,(H,26,28)/b23-20+ |
| InChIKey | QAFPTWDSUKUMIR-BSYVCWPDSA-N |
| XLogP | 5.54 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|