C25H25N3O2S — CID 5147632
2-cyano-3-(4-ethylanilino)-N-(furan-2-ylmethyl)-3-[(2-methylphenyl)methylsulfanyl]prop-2-enamide (PubChem CID 5147632) has the molecular formula C25H25N3O2S and a molecular weight of 431.56 g/mol. Its IUPAC name is 2-cyano-3-(4-ethylanilino)-N-(furan-2-ylmethyl)-3-[(2-methylphenyl)methylsulfanyl]prop-2-enamide.
| Compound Name | 2-cyano-3-(4-ethylanilino)-N-(furan-2-ylmethyl)-3-[(2-methylphenyl)methylsulfanyl]prop-2-enamide |
|---|---|
| PubChem CID | 5147632 |
| Molecular Formula | C25H25N3O2S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 2-cyano-3-(4-ethylanilino)-N-(furan-2-ylmethyl)-3-[(2-methylphenyl)methylsulfanyl]prop-2-enamide |
| SMILES | CCc1ccc(NC(SCc2ccccc2C)=C(C#N)C(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C25H25N3O2S/c1-3-19-10-12-21(13-11-19)28-25(31-17-20-8-5-4-7-18(20)2)23(15-26)24(29)27-16-22-9-6-14-30-22/h4-14,28H,3,16-17H2,1-2H3,(H,27,29) |
| InChIKey | IBICLIBFDUSUEL-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|