C26H23ClN4O2S — CID 4113232
3-anilino-N-(4-chlorophenyl)-2-cyano-3-[2-(4-ethylanilino)-2-oxoethyl]sulfanylprop-2-enamide (PubChem CID 4113232) has the molecular formula C26H23ClN4O2S and a molecular weight of 491.02 g/mol. Its IUPAC name is 3-anilino-N-(4-chlorophenyl)-2-cyano-3-[2-(4-ethylanilino)-2-oxoethyl]sulfanylprop-2-enamide.
| Compound Name | 3-anilino-N-(4-chlorophenyl)-2-cyano-3-[2-(4-ethylanilino)-2-oxoethyl]sulfanylprop-2-enamide |
|---|---|
| PubChem CID | 4113232 |
| Molecular Formula | C26H23ClN4O2S |
| Molecular Weight | 491.02 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 3-anilino-N-(4-chlorophenyl)-2-cyano-3-[2-(4-ethylanilino)-2-oxoethyl]sulfanylprop-2-enamide |
| SMILES | CCc1ccc(NC(=O)CSC(Nc2ccccc2)=C(C#N)C(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H23ClN4O2S/c1-2-18-8-12-21(13-9-18)29-24(32)17-34-26(31-20-6-4-3-5-7-20)23(16-28)25(33)30-22-14-10-19(27)11-15-22/h3-15,31H,2,17H2,1H3,(H,29,32)(H,30,33) |
| InChIKey | VMYTXOOOGZVAAD-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 94.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.02 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|