C16H13ClN2OS — CID 7603938
2-(4-chlorophenyl)sulfanyl-N-[4-(cyanomethyl)phenyl]acetamide (PubChem CID 7603938) has the molecular formula C16H13ClN2OS and a molecular weight of 316.81 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[4-(cyanomethyl)phenyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[4-(cyanomethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 7603938 |
| Molecular Formula | C16H13ClN2OS |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[4-(cyanomethyl)phenyl]acetamide |
| SMILES | N#CCc1ccc(NC(=O)CSc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H13ClN2OS/c17-13-3-7-15(8-4-13)21-11-16(20)19-14-5-1-12(2-6-14)9-10-18/h1-8H,9,11H2,(H,19,20) |
| InChIKey | MWICKFOMSAXLHM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |