C12H11N2O3S- — CID 6930186
2-[2-[4-(cyanomethyl)anilino]-2-oxoethyl]sulfanylacetate (PubChem CID 6930186) has the molecular formula C12H11N2O3S- and a molecular weight of 263.30 g/mol. Its IUPAC name is 2-[2-[4-(cyanomethyl)anilino]-2-oxoethyl]sulfanylacetate.
| Compound Name | 2-[2-[4-(cyanomethyl)anilino]-2-oxoethyl]sulfanylacetate |
|---|---|
| PubChem CID | 6930186 |
| Molecular Formula | C12H11N2O3S- |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 2-[2-[4-(cyanomethyl)anilino]-2-oxoethyl]sulfanylacetate |
| SMILES | N#CCc1ccc(NC(=O)CSCC(=O)[O-])cc1 |
| InChI | InChI=1S/C12H12N2O3S/c13-6-5-9-1-3-10(4-2-9)14-11(15)7-18-8-12(16)17/h1-4H,5,7-8H2,(H,14,15)(H,16,17)/p-1 |
| InChIKey | WSHDZOFSIXVBRN-UHFFFAOYSA-M |
| XLogP | 0.17 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |