C11H9F3N2O — CID 60731315
N-[4-(cyanomethyl)phenyl]-3,3,3-trifluoropropanamide (PubChem CID 60731315) has the molecular formula C11H9F3N2O and a molecular weight of 242.20 g/mol. Its IUPAC name is N-[4-(cyanomethyl)phenyl]-3,3,3-trifluoropropanamide.
| Compound Name | N-[4-(cyanomethyl)phenyl]-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 60731315 |
| Molecular Formula | C11H9F3N2O |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | N-[4-(cyanomethyl)phenyl]-3,3,3-trifluoropropanamide |
| SMILES | N#CCc1ccc(NC(=O)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H9F3N2O/c12-11(13,14)7-10(17)16-9-3-1-8(2-4-9)5-6-15/h1-4H,5,7H2,(H,16,17) |
| InChIKey | NBIAPYWNWNZADY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |